CAS 721387-90-2 appears in our catalog under these names: Ticlopidine hydrochloride EP Impurity E, Ticlopidine Impurity 5(Ticlopidine EP Impurity E). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-[(2-chlorophenyl)methyl]thieno[3,2-c]pyridin-5-ium (CAS 721387-90-2) is a chemical compound with the molecular formula C14H11ClNS+ and a molecular weight of 260.8 g/mol. IUPAC name: 5-[(2-chlorophenyl)methyl]thieno[3,2-c]pyridin-5-ium. InChIKey: OQXLLGWEACZMFD-UHFFFAOYSA-N.
| Molecular formula | C14H11ClNS+ |
|---|---|
| Molecular weight | 260.8 g/mol |
| IUPAC name | 5-[(2-chlorophenyl)methyl]thieno[3,2-c]pyridin-5-ium |
| InChIKey | OQXLLGWEACZMFD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C[N+]2=CC3=C(C=C2)SC=C3)Cl |
Computed by PubChem (NCBI)