CAS 7214-08-6 appears in our catalog under these names: Zinc Glycinate, >95% (HPLC), Zinc glycinate, Zinc(II) 2-aminoacetate 99%, Zinc(II) 2-Aminoacetate, 99%, 99%. Offered by: TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 500g, 25g, 100g, 1000g, 1kg.
Zinc bis(2-aminoacetate) (CAS 7214-08-6) is a chemical compound with the molecular formula C4H8N2O4Zn and a molecular weight of 213.5 g/mol. IUPAC name: zinc bis(2-aminoacetate). InChIKey: UOXSXMSTSYWNMH-UHFFFAOYSA-L.
| Molecular formula | C4H8N2O4Zn |
|---|---|
| Molecular weight | 213.5 g/mol |
| IUPAC name | zinc bis(2-aminoacetate) |
| InChIKey | UOXSXMSTSYWNMH-UHFFFAOYSA-L |
| SMILES | C(C(=O)[O-])N.C(C(=O)[O-])N.[Zn+2] |
Computed by PubChem (NCBI)