CAS 7214-52-0 is the registry number for (3R,5S)-rel-3,5-Dimethylcyclohexanone. Offered by: TRC. Available pack sizes: 250mg.
Cis-(3S,5R)-3,5-dimethylcyclohexan-1-one (CAS 7214-52-0) is a chemical compound with the molecular formula C8H14O and a molecular weight of 126.20 g/mol. IUPAC name: cis-(3S,5R)-3,5-dimethylcyclohexan-1-one. InChIKey: MSANHHHQJYQEOK-KNVOCYPGSA-N.
| Molecular formula | C8H14O |
|---|---|
| Molecular weight | 126.20 g/mol |
| IUPAC name | cis-(3S,5R)-3,5-dimethylcyclohexan-1-one |
| InChIKey | MSANHHHQJYQEOK-KNVOCYPGSA-N |
| SMILES | C[C@@H]1C[C@@H](CC(=O)C1)C |
Computed by PubChem (NCBI)