CAS 721407-67-6 appears in our catalog under these names: (3,7-Dibenzyl-2,6-dioxo-2,3,6,7-tetrahydro-1h-purin-1-yl)acetic acid, 95%, 2-(3,7-Dibenzyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-1-yl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)acetic acid (CAS 721407-67-6) is a chemical compound with the molecular formula C21H18N4O4 and a molecular weight of 390.4 g/mol. IUPAC name: 2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)acetic acid. InChIKey: SBPCVHSIKOVVDH-UHFFFAOYSA-N.
| Molecular formula | C21H18N4O4 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)acetic acid |
| InChIKey | SBPCVHSIKOVVDH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC3=C2C(=O)N(C(=O)N3CC4=CC=CC=C4)CC(=O)O |
Computed by PubChem (NCBI)