CAS 72142-88-2 appears in our catalog under these names: Dimethyl-d6-cyanamide, Dimethylcyanamide-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5g, 250mg, 250 mg, 100 mg, 1 g.
Bis(trideuteriomethyl)cyanamide (CAS 72142-88-2) is a chemical compound with the molecular formula C3H6N2 and a molecular weight of 76.13 g/mol. IUPAC name: bis(trideuteriomethyl)cyanamide. InChIKey: OAGOUCJGXNLJNL-WFGJKAKNSA-N.
| Molecular formula | C3H6N2 |
|---|---|
| Molecular weight | 76.13 g/mol |
| IUPAC name | bis(trideuteriomethyl)cyanamide |
| InChIKey | OAGOUCJGXNLJNL-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(C#N)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)