CAS 721968-86-1 is the registry number for {4-(2-(Trimethylsilyl)ethynyl)phenyl}methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
[4-(2-trimethylsilylethynyl)phenyl]methanamine (CAS 721968-86-1) is a chemical compound with the molecular formula C12H17NSi and a molecular weight of 203.35 g/mol. IUPAC name: [4-(2-trimethylsilylethynyl)phenyl]methanamine. InChIKey: PRIMLIQJCZQUST-UHFFFAOYSA-N.
| Molecular formula | C12H17NSi |
|---|---|
| Molecular weight | 203.35 g/mol |
| IUPAC name | [4-(2-trimethylsilylethynyl)phenyl]methanamine |
| InChIKey | PRIMLIQJCZQUST-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=CC=C(C=C1)CN |
Computed by PubChem (NCBI)