CAS 72218-68-9 appears in our catalog under these names: 2'–Bromo–2'–deoxyuridine–82Br, 2'-Bromo-2'-deoxyuridine, ≥98%, ≥98%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 500mg.
1-[(2R,3R,4R,5R)-3-bromo-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 72218-68-9) is a chemical compound with the molecular formula C9H11BrN2O5 and a molecular weight of 307.10 g/mol. IUPAC name: 1-[(2R,3R,4R,5R)-3-bromo-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: FEUDNSHXOOLCEY-XVFCMESISA-N.
| Molecular formula | C9H11BrN2O5 |
|---|---|
| Molecular weight | 307.10 g/mol |
| IUPAC name | 1-[(2R,3R,4R,5R)-3-bromo-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | FEUDNSHXOOLCEY-XVFCMESISA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)Br |
Computed by PubChem (NCBI)