Products 72254-43-4
CAS 72254-43-4 is the registry number for 11-Oxahomofolic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethoxy]benzoyl]amino]pentanedioic acid (CAS 72254-43-4) is a chemical compound with the molecular formula C20H20N6O7 and a molecular weight of 456.4 g/mol. IUPAC name: (2S)-2-[[4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethoxy]benzoyl]amino]pentanedioic acid. InChIKey: KIWDKYBQSARKOL-ZDUSSCGKSA-N.
| Molecular formula | C20H20N6O7 |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | (2S)-2-[[4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethoxy]benzoyl]amino]pentanedioic acid |
| InChIKey | KIWDKYBQSARKOL-ZDUSSCGKSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)OCCC2=CN=C3C(=N2)C(=O)NC(=N3)N |
Computed by PubChem (NCBI)