CAS 7226-33-7 is the registry number for 2-Deoxy-2-fluoro-D-ribofuranose. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg.
(2R,3R,4R)-2-fluoro-3,4,5-trihydroxypentanal (CAS 7226-33-7) is a chemical compound with the molecular formula C5H9FO4 and a molecular weight of 152.12 g/mol. IUPAC name: (2R,3R,4R)-2-fluoro-3,4,5-trihydroxypentanal. InChIKey: NJYXSKVOTDPOAT-LMVFSUKVSA-N.
| Molecular formula | C5H9FO4 |
|---|---|
| Molecular weight | 152.12 g/mol |
| IUPAC name | (2R,3R,4R)-2-fluoro-3,4,5-trihydroxypentanal |
| InChIKey | NJYXSKVOTDPOAT-LMVFSUKVSA-N |
| SMILES | C([C@H]([C@H]([C@H](C=O)F)O)O)O |
Computed by PubChem (NCBI)