CAS 72278-32-1 is the registry number for preQ1 (hydrochloride). Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 25mg, 5mg.
2-amino-5-(aminomethyl)-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one;hydrochloride (CAS 72278-32-1) is a chemical compound with the molecular formula C7H10ClN5O and a molecular weight of 215.64 g/mol. IUPAC name: 2-amino-5-(aminomethyl)-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one;hydrochloride. InChIKey: AHDQVQXCHCTEFD-UHFFFAOYSA-N.
| Molecular formula | C7H10ClN5O |
|---|---|
| Molecular weight | 215.64 g/mol |
| IUPAC name | 2-amino-5-(aminomethyl)-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one;hydrochloride |
| InChIKey | AHDQVQXCHCTEFD-UHFFFAOYSA-N |
| SMILES | C1=C(C2C(=O)NC(=NC2=N1)N)CN.Cl |
Computed by PubChem (NCBI)