CAS 72310-28-2 is the registry number for 2-Chloronaphtho[1,8-d,e][1,3,2]dioxaphosphinine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-chloro-2,4-dioxa-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (CAS 72310-28-2) is a chemical compound with the molecular formula C10H6ClO2P and a molecular weight of 224.58 g/mol. IUPAC name: 3-chloro-2,4-dioxa-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene. InChIKey: VVKNLQOLORCUNS-UHFFFAOYSA-N.
| Molecular formula | C10H6ClO2P |
|---|---|
| Molecular weight | 224.58 g/mol |
| IUPAC name | 3-chloro-2,4-dioxa-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| InChIKey | VVKNLQOLORCUNS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)OP(OC3=CC=C2)Cl |
Computed by PubChem (NCBI)