CAS 72396-65-7 is the registry number for 4,5-Dichloro-2-(3-chloro-4-fluorophenyl)pyridazin-3(2H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dichloro-2-(3-chloro-4-fluorophenyl)pyridazin-3-one (CAS 72396-65-7) is a chemical compound with the molecular formula C10H4Cl3FN2O and a molecular weight of 293.5 g/mol. IUPAC name: 4,5-dichloro-2-(3-chloro-4-fluorophenyl)pyridazin-3-one. InChIKey: DPDKBLILZSKEND-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl3FN2O |
|---|---|
| Molecular weight | 293.5 g/mol |
| IUPAC name | 4,5-dichloro-2-(3-chloro-4-fluorophenyl)pyridazin-3-one |
| InChIKey | DPDKBLILZSKEND-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C(=O)C(=C(C=N2)Cl)Cl)Cl)F |
Computed by PubChem (NCBI)