CAS 72426-83-6 is the registry number for Platinum, dichloro(1-phenyl-1,2-ethanediamine-N,N')-, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-azanidyl-1-phenylethyl)azanide;dichloroplatinum(2+) (CAS 72426-83-6) is a chemical compound with the molecular formula C8H10Cl2N2Pt and a molecular weight of 400.17 g/mol. IUPAC name: (2-azanidyl-1-phenylethyl)azanide;dichloroplatinum(2+). InChIKey: YCPRCBIVXDWLLI-UHFFFAOYSA-L.
| Molecular formula | C8H10Cl2N2Pt |
|---|---|
| Molecular weight | 400.17 g/mol |
| IUPAC name | (2-azanidyl-1-phenylethyl)azanide;dichloroplatinum(2+) |
| InChIKey | YCPRCBIVXDWLLI-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)C(C[NH-])[NH-].Cl[Pt+2]Cl |
Computed by PubChem (NCBI)