CAS 72444-63-4 is the registry number for Lodiperone. Offered by: TRC. Available pack sizes: 50mg.
5-[2-[4-(3,5-dichlorophenyl)piperazin-1-yl]ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one (CAS 72444-63-4) is a chemical compound with the molecular formula C21H20Cl2FN3O2 and a molecular weight of 436.3 g/mol. IUPAC name: 5-[2-[4-(3,5-dichlorophenyl)piperazin-1-yl]ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one. InChIKey: VIASEBSYVIYYEZ-UHFFFAOYSA-N.
| Molecular formula | C21H20Cl2FN3O2 |
|---|---|
| Molecular weight | 436.3 g/mol |
| IUPAC name | 5-[2-[4-(3,5-dichlorophenyl)piperazin-1-yl]ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one |
| InChIKey | VIASEBSYVIYYEZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCC2=C(NC(=O)O2)C3=CC=C(C=C3)F)C4=CC(=CC(=C4)Cl)Cl |
Computed by PubChem (NCBI)