CAS 7246-20-0 is the registry number for Triclofos (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 2,2,2-trichloroethyl hydrogen phosphate (CAS 7246-20-0) is a chemical compound with the molecular formula C2H3Cl3NaO4P and a molecular weight of 251.36 g/mol. IUPAC name: sodium 2,2,2-trichloroethyl hydrogen phosphate. InChIKey: WFKJEZKHPGDCRK-UHFFFAOYSA-M.
| Molecular formula | C2H3Cl3NaO4P |
|---|---|
| Molecular weight | 251.36 g/mol |
| IUPAC name | sodium 2,2,2-trichloroethyl hydrogen phosphate |
| InChIKey | WFKJEZKHPGDCRK-UHFFFAOYSA-M |
| SMILES | C(C(Cl)(Cl)Cl)OP(=O)(O)[O-].[Na+] |
Computed by PubChem (NCBI)