Products 7247-57-6
CAS 7247-57-6 is the registry number for Heteronium Bromide. Offered by: Mikromol, LoGiCal, Biosynth. Available pack sizes: 50mg, 10mg, 25mg.
(1,1-dimethylpyrrolidin-1-ium-3-yl) 2-hydroxy-2-phenyl-2-thiophen-2-ylacetate bromide (CAS 7247-57-6) is a chemical compound with the molecular formula C18H22BrNO3S and a molecular weight of 412.3 g/mol. IUPAC name: (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-hydroxy-2-phenyl-2-thiophen-2-ylacetate bromide. InChIKey: SHPIBZXFYWMQBR-UHFFFAOYSA-M.
| Molecular formula | C18H22BrNO3S |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-hydroxy-2-phenyl-2-thiophen-2-ylacetate bromide |
| InChIKey | SHPIBZXFYWMQBR-UHFFFAOYSA-M |
| SMILES | C[N+]1(CCC(C1)OC(=O)C(C2=CC=CC=C2)(C3=CC=CS3)O)C.[Br-] |
Computed by PubChem (NCBI)
Synonyms:
HETERONIUM BROMIDE, Hetrum bromide, Heteronii bromidum, Bromure d'heteronium, Bromuro de heteronio, Pyrrolidinium, 3-((hydroxyphenyl-2-thienylacetyl)oxy)-1,1-dimethyl-, bromide, Heteronii bromidum [INN-Latin], Bromure d'heteronium [INN-French], Bromuro de heteronio [INN-Spanish], Heteronium bromide [USAN:INN:BAN]