Products 724707-85-1

CAS 724707-85-1 is the registry number for Trifluoromethanesulfonic acid 7-methoxy-3,4-dihydronaphthalen-1-yl ester, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

(7-methoxy-3,4-dihydronaphthalen-1-yl) trifluoromethanesulfonate (CAS 724707-85-1) is a chemical compound with the molecular formula C12H11F3O4S and a molecular weight of 308.28 g/mol. IUPAC name: (7-methoxy-3,4-dihydronaphthalen-1-yl) trifluoromethanesulfonate. InChIKey: NFDMYSLNTNONFR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11F3O4S
Molecular weight308.28 g/mol
IUPAC name(7-methoxy-3,4-dihydronaphthalen-1-yl) trifluoromethanesulfonate
InChIKeyNFDMYSLNTNONFR-UHFFFAOYSA-N
SMILESCOC1=CC2=C(CCC=C2OS(=O)(=O)C(F)(F)F)C=C1

Computed by PubChem (NCBI)