CAS 724711-21-1 appears in our catalog under these names: MK2–IN–3, MK2 Inhibitor III, MK2-IN-3/ 98.14% (existing batch purity), MK2-IN-3 99%, MK2-IN-3, 99%, 99%. Offered by: GLPBio, TRC, TargetMol, Biosynth, Ambeed. Available pack sizes: 1mg, 2,5mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 2mg, 50mg.
2-(2-quinolin-3-yl-4-pyridinyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (CAS 724711-21-1) is a chemical compound with the molecular formula C21H16N4O and a molecular weight of 340.4 g/mol. IUPAC name: 2-(2-quinolin-3-yl-4-pyridinyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one. InChIKey: OWFLADWRSCINST-UHFFFAOYSA-N.
| Molecular formula | C21H16N4O |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 2-(2-quinolin-3-yl-4-pyridinyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| InChIKey | OWFLADWRSCINST-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1NC(=C2)C3=CC(=NC=C3)C4=CC5=CC=CC=C5N=C4 |
Computed by PubChem (NCBI)