CAS 724762-79-2 appears in our catalog under these names: Ethinylestradiol Impurity 16, Ethynyl Estradiol 3-Sulfate Sodium Salt (>85%), >95% (HPLC), Ethynyl estradiol 3-sulfate sodium salt, Ethynylestradiol 3-sulfate (sodium), 96.93%. Offered by: Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg, 5mg.
Sodium [(8R,9S,13S,14S,17R)-17-ethynyl-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfate (CAS 724762-79-2) is a chemical compound with the molecular formula C20H23NaO5S and a molecular weight of 398.4 g/mol. IUPAC name: sodium [(8R,9S,13S,14S,17R)-17-ethynyl-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfate. InChIKey: CXNYTWLEPKFJAE-KBRHESHBSA-M.
| Molecular formula | C20H23NaO5S |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | sodium [(8R,9S,13S,14S,17R)-17-ethynyl-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfate |
| InChIKey | CXNYTWLEPKFJAE-KBRHESHBSA-M |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C#C)O)CCC4=C3C=CC(=C4)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)