CAS 725215-59-8 is the registry number for 5-Bromo-N-(isoxazol-3-yl)thiophene-2-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(1,2-oxazol-3-yl)thiophene-2-sulfonamide (CAS 725215-59-8) is a chemical compound with the molecular formula C7H5BrN2O3S2 and a molecular weight of 309.2 g/mol. IUPAC name: 5-bromo-N-(1,2-oxazol-3-yl)thiophene-2-sulfonamide. InChIKey: XYGMNLFJHUYEKM-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O3S2 |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 5-bromo-N-(1,2-oxazol-3-yl)thiophene-2-sulfonamide |
| InChIKey | XYGMNLFJHUYEKM-UHFFFAOYSA-N |
| SMILES | C1=CON=C1NS(=O)(=O)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)