Products 725234-39-9

CAS 725234-39-9 is the registry number for Imidazo[2,1-b]thiazole-6-carboxylic acid hydrobromide, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Imidazo[2,1-b][1,3]thiazole-6-carboxylic acid;hydrobromide (CAS 725234-39-9) is a chemical compound with the molecular formula C6H5BrN2O2S and a molecular weight of 249.09 g/mol. IUPAC name: imidazo[2,1-b][1,3]thiazole-6-carboxylic acid;hydrobromide. InChIKey: RAVYQOPXHWEAFU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BrN2O2S
Molecular weight249.09 g/mol
IUPAC nameimidazo[2,1-b][1,3]thiazole-6-carboxylic acid;hydrobromide
InChIKeyRAVYQOPXHWEAFU-UHFFFAOYSA-N
SMILESC1=CSC2=NC(=CN21)C(=O)O.Br

Computed by PubChem (NCBI)