CAS 72524-90-4 appears in our catalog under these names: Perbromothiophene 1,1-dioxide, 98%, Perbromothiophene 1,1-dioxide, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g.
2,3,4,5-tetrabromothiophene 1,1-dioxide (CAS 72524-90-4) is a chemical compound with the molecular formula C4Br4O2S and a molecular weight of 431.72 g/mol. IUPAC name: 2,3,4,5-tetrabromothiophene 1,1-dioxide. InChIKey: DNZIPZUCSUGNIV-UHFFFAOYSA-N.
| Molecular formula | C4Br4O2S |
|---|---|
| Molecular weight | 431.72 g/mol |
| IUPAC name | 2,3,4,5-tetrabromothiophene 1,1-dioxide |
| InChIKey | DNZIPZUCSUGNIV-UHFFFAOYSA-N |
| SMILES | C1(=C(S(=O)(=O)C(=C1Br)Br)Br)Br |
Computed by PubChem (NCBI)