CAS 7253-07-8 appears in our catalog under these names: (9-Fluorenyl)triphenylphosphonium bromide, 95%, (9H-Fluoren-9-yl)triphenylphosphonium bromide, 98%(HPLC),RG, 98%(HPLC),RG. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g.
9H-fluoren-9-yl(triphenyl)phosphanium bromide (CAS 7253-07-8) is a chemical compound with the molecular formula C31H24BrP and a molecular weight of 507.4 g/mol. IUPAC name: 9H-fluoren-9-yl(triphenyl)phosphanium bromide. InChIKey: BHNPKGAMAZKCCJ-UHFFFAOYSA-M.
| Molecular formula | C31H24BrP |
|---|---|
| Molecular weight | 507.4 g/mol |
| IUPAC name | 9H-fluoren-9-yl(triphenyl)phosphanium bromide |
| InChIKey | BHNPKGAMAZKCCJ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](C2C3=CC=CC=C3C4=CC=CC=C24)(C5=CC=CC=C5)C6=CC=CC=C6.[Br-] |
Computed by PubChem (NCBI)