CAS 7254-06-0 appears in our catalog under these names: 3-Chloro-9-fluorenone, 95%, 3-Chloro-9-fluorenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 50mg, 25mg.
3-chlorofluoren-9-one (CAS 7254-06-0) is a chemical compound with the molecular formula C13H7ClO and a molecular weight of 214.64 g/mol. IUPAC name: 3-chlorofluoren-9-one. InChIKey: VHKPWMGKYILMAU-UHFFFAOYSA-N.
| Molecular formula | C13H7ClO |
|---|---|
| Molecular weight | 214.64 g/mol |
| IUPAC name | 3-chlorofluoren-9-one |
| InChIKey | VHKPWMGKYILMAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C=CC(=C3)Cl |
Computed by PubChem (NCBI)