CAS 725695-54-5 appears in our catalog under these names: 4-(3,4-Dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidine, ≥95%, ≥95%, EP2 modulator-1, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
4-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidine (CAS 725695-54-5) is a chemical compound with the molecular formula C18H21F3N4O2 and a molecular weight of 382.4 g/mol. IUPAC name: 4-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidine. InChIKey: QZTGRXWLETZUEB-UHFFFAOYSA-N.
| Molecular formula | C18H21F3N4O2 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | 4-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidine |
| InChIKey | QZTGRXWLETZUEB-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC(=CC(=N2)C(F)(F)F)C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)