Products 72573-82-1
CAS 72573-82-1 appears in our catalog under these names: Gadoteric Acid, Gadoteric acid. Offered by: Chemat Brand, TRC, GLPBio. Available pack sizes: on request, 100mg, 25mg, 50mg, 250mg.
2-[4,7-bis(carboxylatomethyl)-10-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) (CAS 72573-82-1) is a chemical compound with the molecular formula C16H25GdN4O8 and a molecular weight of 558.64 g/mol. IUPAC name: 2-[4,7-bis(carboxylatomethyl)-10-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+). InChIKey: GFSTXYOTEVLASN-UHFFFAOYSA-K.
| Molecular formula | C16H25GdN4O8 |
|---|---|
| Molecular weight | 558.64 g/mol |
| IUPAC name | 2-[4,7-bis(carboxylatomethyl)-10-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
| InChIKey | GFSTXYOTEVLASN-UHFFFAOYSA-K |
| SMILES | C1CN(CCN(CCN(CCN1CC(=O)O)CC(=O)[O-])CC(=O)[O-])CC(=O)[O-].[Gd+3] |
Computed by PubChem (NCBI)