CAS 725745-08-4 appears in our catalog under these names: Dichlorobis(chlorodi-tert-butylphosphine)palladium (ii), 97%, PXPD, dichlorobis(chlorodi-tert-butylphosphine) palladium (ii), Dichlorobis(chlorodi-tert-butylphosphine)palladium (ii), 97%, 97%, Dichlorobis(chlorodi-tert-butylphosphine) palladium(II), 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 5000mg, 100mg.
Bis(ditert-butyl(chloro)phosphane);dichloropalladium (CAS 725745-08-4) is a chemical compound with the molecular formula C16H36Cl4P2Pd and a molecular weight of 538.6 g/mol. IUPAC name: bis(ditert-butyl(chloro)phosphane);dichloropalladium. InChIKey: SBVNVPYALHOWLN-UHFFFAOYSA-L.
| Molecular formula | C16H36Cl4P2Pd |
|---|---|
| Molecular weight | 538.6 g/mol |
| IUPAC name | bis(ditert-butyl(chloro)phosphane);dichloropalladium |
| InChIKey | SBVNVPYALHOWLN-UHFFFAOYSA-L |
| SMILES | CC(C)(C)P(C(C)(C)C)Cl.CC(C)(C)P(C(C)(C)C)Cl.Cl[Pd]Cl |
Computed by PubChem (NCBI)