CAS 726-41-0 is the registry number for 1,3-Bis(p-bromophenyl)carbodiimide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
N,N'-bis(4-bromophenyl)methanediimine (CAS 726-41-0) is a chemical compound with the molecular formula C13H8Br2N2 and a molecular weight of 352.02 g/mol. IUPAC name: N,N'-bis(4-bromophenyl)methanediimine. InChIKey: PIMZILIECAOPJI-UHFFFAOYSA-N.
| Molecular formula | C13H8Br2N2 |
|---|---|
| Molecular weight | 352.02 g/mol |
| IUPAC name | N,N'-bis(4-bromophenyl)methanediimine |
| InChIKey | PIMZILIECAOPJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C=NC2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)