CAS 726134-79-8 appears in our catalog under these names: Zolmitriptan Impurity 11, (S)-2-Amino-3-(4-aminophenyl)propan-1-ol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
(2S)-2-amino-3-(4-aminophenyl)propan-1-ol (CAS 726134-79-8) is a chemical compound with the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. IUPAC name: (2S)-2-amino-3-(4-aminophenyl)propan-1-ol. InChIKey: GMTRSZXBNADBMK-VIFPVBQESA-N.
| Molecular formula | C9H14N2O |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-aminophenyl)propan-1-ol |
| InChIKey | GMTRSZXBNADBMK-VIFPVBQESA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](CO)N)N |
Computed by PubChem (NCBI)