CAS 726157-37-5 appears in our catalog under these names: 2-Chloro-n-(3,5-dichloro-phenyl)-2-phenyl-acetamide, 95%, 2-Chloro-N-(3,5-dichlorophenyl)-2-phenylacetamide, 95%, 2-Chloro-N-(3,5-dichlorophenyl)-2-phenylacetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-chloro-N-(3,5-dichlorophenyl)-2-phenylacetamide (CAS 726157-37-5) is a chemical compound with the molecular formula C14H10Cl3NO and a molecular weight of 314.6 g/mol. IUPAC name: 2-chloro-N-(3,5-dichlorophenyl)-2-phenylacetamide. InChIKey: MCXJDPBZXJMZKR-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl3NO |
|---|---|
| Molecular weight | 314.6 g/mol |
| IUPAC name | 2-chloro-N-(3,5-dichlorophenyl)-2-phenylacetamide |
| InChIKey | MCXJDPBZXJMZKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)NC2=CC(=CC(=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)