CAS 726181-70-0 appears in our catalog under these names: Fmoc-3-amino-L-tyrosine, ≥95%, ≥95%, Fmoc-3-amino-L-tyrosine, 97%, Fmoc-3-Amino-L-Tyrosine, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
(2S)-3-(3-amino-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 726181-70-0) is a chemical compound with the molecular formula C24H22N2O5 and a molecular weight of 418.4 g/mol. IUPAC name: (2S)-3-(3-amino-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: DNIZNEVDYHGUPY-NRFANRHFSA-N.
| Molecular formula | C24H22N2O5 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | (2S)-3-(3-amino-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | DNIZNEVDYHGUPY-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=C(C=C4)O)N)C(=O)O |
Computed by PubChem (NCBI)