CAS 7262-40-0 appears in our catalog under these names: Fluorescein Dibenzoate, 3-Oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-3',6'-diyl dibenzoate 95%, 3-Oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-3',6'-diyl dibenzoate, 95%, 95%. Offered by: TRC, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 25mg, 1g, 5g.
(6'-benzoyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) benzoate (CAS 7262-40-0) is a chemical compound with the molecular formula C34H20O7 and a molecular weight of 540.5 g/mol. IUPAC name: (6'-benzoyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) benzoate. InChIKey: JOPVUXANUVWNPD-UHFFFAOYSA-N.
| Molecular formula | C34H20O7 |
|---|---|
| Molecular weight | 540.5 g/mol |
| IUPAC name | (6'-benzoyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) benzoate |
| InChIKey | JOPVUXANUVWNPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC3=C(C=C2)C4(C5=C(O3)C=C(C=C5)OC(=O)C6=CC=CC=C6)C7=CC=CC=C7C(=O)O4 |
Computed by PubChem (NCBI)