CAS 72629-94-8 appears in our catalog under these names: Perfluorotridecanoic acid, 95%, Perfluorotridecanoic Acid, Perfluorotridecanoic Acid (>85%), Perfluorotridecanoic acid 50 µg/mL in Methanol:Water, Perfluorotridecanoic acid. Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 1g, 10g, on request, 100mg, 500mg, 50mg, 25mg, 1ml.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentacosafluorotridecanoic acid (CAS 72629-94-8) is a chemical compound with the molecular formula C13HF25O2 and a molecular weight of 664.10 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentacosafluorotridecanoic acid. InChIKey: LVDGGZAZAYHXEY-UHFFFAOYSA-N.
| Molecular formula | C13HF25O2 |
|---|---|
| Molecular weight | 664.10 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentacosafluorotridecanoic acid |
| InChIKey | LVDGGZAZAYHXEY-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)