CAS 7267-92-7 appears in our catalog under these names: Aristolochic acid III, 10-Methoxy-6-nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid, ≥95%, ≥95%, Aristolochic acid III, 85.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1 mg, 5 mg.
10-methoxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid (CAS 7267-92-7) is a chemical compound with the molecular formula C17H11NO7 and a molecular weight of 341.27 g/mol. IUPAC name: 10-methoxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid. InChIKey: MYVJZUBEKPWUFP-UHFFFAOYSA-N.
| Molecular formula | C17H11NO7 |
|---|---|
| Molecular weight | 341.27 g/mol |
| IUPAC name | 10-methoxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid |
| InChIKey | MYVJZUBEKPWUFP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C3C(=C(C=C2C=C1)[N+](=O)[O-])C(=CC4=C3OCO4)C(=O)O |
Computed by PubChem (NCBI)