CAS 72699-18-4 appears in our catalog under these names: KWG 1342, Triadimenol-tert-butylhydroxy. Offered by: TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: 100mg, 5mg, 25mg, 10mg, 50mg.
4-(4-chlorophenoxy)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)butane-1,3-diol (CAS 72699-18-4) is a chemical compound with the molecular formula C14H18ClN3O3 and a molecular weight of 311.76 g/mol. IUPAC name: 4-(4-chlorophenoxy)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)butane-1,3-diol. InChIKey: JLTVUDQTJZNYKA-UHFFFAOYSA-N.
| Molecular formula | C14H18ClN3O3 |
|---|---|
| Molecular weight | 311.76 g/mol |
| IUPAC name | 4-(4-chlorophenoxy)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)butane-1,3-diol |
| InChIKey | JLTVUDQTJZNYKA-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)C(C(N1C=NC=N1)OC2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)