Products 72705-22-7

CAS 72705-22-7 is the registry number for 3-Acetoacetylamino-4-methoxytoluene-6-sulfonic acid ammonium salt, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

Azanium 5-methoxy-2-methyl-4-(3-oxobutanoylamino)benzenesulfonate (CAS 72705-22-7) is a chemical compound with the molecular formula C12H18N2O6S and a molecular weight of 318.35 g/mol. IUPAC name: azanium 5-methoxy-2-methyl-4-(3-oxobutanoylamino)benzenesulfonate. InChIKey: ZPDRZMNAFLBUOA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18N2O6S
Molecular weight318.35 g/mol
IUPAC nameazanium 5-methoxy-2-methyl-4-(3-oxobutanoylamino)benzenesulfonate
InChIKeyZPDRZMNAFLBUOA-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1S(=O)(=O)[O-])OC)NC(=O)CC(=O)C.[NH4+]

Computed by PubChem (NCBI)