CAS 72718-01-5 is the registry number for 2-Azidoethyl 2,3,4-tri-O-acetyl-β-D-xylopyranoside. Offered by: Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg.
1-[(2R,3R,4S,5R)-4,5-diacetyl-2-(2-azidoethoxy)oxan-3-yl]propan-2-one (CAS 72718-01-5) is a chemical compound with the molecular formula C14H21N3O5 and a molecular weight of 311.33 g/mol. IUPAC name: 1-[(2R,3R,4S,5R)-4,5-diacetyl-2-(2-azidoethoxy)oxan-3-yl]propan-2-one. InChIKey: FOQHIFKEZODQOW-MQYQWHSLSA-N.
| Molecular formula | C14H21N3O5 |
|---|---|
| Molecular weight | 311.33 g/mol |
| IUPAC name | 1-[(2R,3R,4S,5R)-4,5-diacetyl-2-(2-azidoethoxy)oxan-3-yl]propan-2-one |
| InChIKey | FOQHIFKEZODQOW-MQYQWHSLSA-N |
| SMILES | CC(=O)C[C@@H]1[C@@H]([C@H](CO[C@@H]1OCCN=[N+]=[N-])C(=O)C)C(=O)C |
Computed by PubChem (NCBI)