CAS 727676-30-4 appears in our catalog under these names: 3-(1-Adamantylthio)-1,2,4-thiadiazol-5-amine, 95%, 3-(Adamantan-1-ylthio)-1,2,4-thiadiazol-5-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-(1-adamantylsulfanyl)-1,2,4-thiadiazol-5-amine (CAS 727676-30-4) is a chemical compound with the molecular formula C12H17N3S2 and a molecular weight of 267.4 g/mol. IUPAC name: 3-(1-adamantylsulfanyl)-1,2,4-thiadiazol-5-amine. InChIKey: KLMCXAZBYOGSEU-UHFFFAOYSA-N.
| Molecular formula | C12H17N3S2 |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | 3-(1-adamantylsulfanyl)-1,2,4-thiadiazol-5-amine |
| InChIKey | KLMCXAZBYOGSEU-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)SC4=NSC(=N4)N |
Computed by PubChem (NCBI)