CAS 727689-54-5 appears in our catalog under these names: 4-[4-(2-Chlorophenoxy)phenylsulfonylaminomethyl]benzoic acid, 95%, 4-(((4-(2-Chlorophenoxy)phenyl)sulfonamido)methyl)benzoic Acid, 4-[4-(2-Chlorophenoxy)phenylsulfonylaminomethyl]benzoic acid, 97%, 97%, 4-(((4-(2-Chlorophenoxy)phenyl)sulfonamido)methyl)benzoic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 50mg, 0,5g, 100mg.
4-[[[4-(2-chlorophenoxy)phenyl]sulfonylamino]methyl]benzoic acid (CAS 727689-54-5) is a chemical compound with the molecular formula C20H16ClNO5S and a molecular weight of 417.9 g/mol. IUPAC name: 4-[[[4-(2-chlorophenoxy)phenyl]sulfonylamino]methyl]benzoic acid. InChIKey: NSXMPQYOUHHCQB-UHFFFAOYSA-N.
| Molecular formula | C20H16ClNO5S |
|---|---|
| Molecular weight | 417.9 g/mol |
| IUPAC name | 4-[[[4-(2-chlorophenoxy)phenyl]sulfonylamino]methyl]benzoic acid |
| InChIKey | NSXMPQYOUHHCQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=CC=C(C=C2)S(=O)(=O)NCC3=CC=C(C=C3)C(=O)O)Cl |
Computed by PubChem (NCBI)