CAS 727704-78-1 appears in our catalog under these names: 2-Isopropoxy-5-(piperidin-1-ylsulfonyl)aniline, 95%, 5-(Piperidine-1-sulfonyl)-2-(propan-2-yloxy)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 100mg.
5-piperidin-1-ylsulfonyl-2-propan-2-yloxyaniline (CAS 727704-78-1) is a chemical compound with the molecular formula C14H22N2O3S and a molecular weight of 298.40 g/mol. IUPAC name: 5-piperidin-1-ylsulfonyl-2-propan-2-yloxyaniline. InChIKey: YQGAQXKCPOUPGH-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O3S |
|---|---|
| Molecular weight | 298.40 g/mol |
| IUPAC name | 5-piperidin-1-ylsulfonyl-2-propan-2-yloxyaniline |
| InChIKey | YQGAQXKCPOUPGH-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)S(=O)(=O)N2CCCCC2)N |
Computed by PubChem (NCBI)