CAS 727717-72-8 appears in our catalog under these names: ([4-(4-Chlorophenyl)-5-phenyl-4h-1,2,4-triazol-3-yl]thio)acetic acid, 95%, 2-{(4-(4-Chlorophenyl)-5-phenyl-4H-1,2,4-triazol-3-yl)sulfanyl}acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 10g, 0,5g.
2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid (CAS 727717-72-8) is a chemical compound with the molecular formula C16H12ClN3O2S and a molecular weight of 345.8 g/mol. IUPAC name: 2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid. InChIKey: JCPATHOSANGUEU-UHFFFAOYSA-N.
| Molecular formula | C16H12ClN3O2S |
|---|---|
| Molecular weight | 345.8 g/mol |
| IUPAC name | 2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| InChIKey | JCPATHOSANGUEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(N2C3=CC=C(C=C3)Cl)SCC(=O)O |
Computed by PubChem (NCBI)