CAS 727718-11-8 appears in our catalog under these names: 1-([4-Chloro-3-(trifluoromethyl)phenyl]sulfonyl)piperidine-4-carboxylic acid, 95%, 1-(4-Chloro-3-(trifluoromethyl)benzenesulfonyl)piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylic acid (CAS 727718-11-8) is a chemical compound with the molecular formula C13H13ClF3NO4S and a molecular weight of 371.76 g/mol. IUPAC name: 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylic acid. InChIKey: LUVBPRSIHUQMSZ-UHFFFAOYSA-N.
| Molecular formula | C13H13ClF3NO4S |
|---|---|
| Molecular weight | 371.76 g/mol |
| IUPAC name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylic acid |
| InChIKey | LUVBPRSIHUQMSZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)S(=O)(=O)C2=CC(=C(C=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)