CAS 727718-93-6 appears in our catalog under these names: Losartan Impurity 21, Losartan Potassium Impurity 1, Losartan Impurity 24, Losartan Azide, >95% (HPLC), Losartan Azide. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 250μg.
5-[2-[4-[[5-(azidomethyl)-2-butyl-4-chloroimidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole (CAS 727718-93-6) is a chemical compound with the molecular formula C22H22ClN9 and a molecular weight of 447.9 g/mol. IUPAC name: 5-[2-[4-[[5-(azidomethyl)-2-butyl-4-chloroimidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole. InChIKey: WSECDZBYSJWHFL-UHFFFAOYSA-N.
| Molecular formula | C22H22ClN9 |
|---|---|
| Molecular weight | 447.9 g/mol |
| IUPAC name | 5-[2-[4-[[5-(azidomethyl)-2-butyl-4-chloroimidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole |
| InChIKey | WSECDZBYSJWHFL-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NNN=N4)CN=[N+]=[N-])Cl |
Computed by PubChem (NCBI)