CAS 72821-91-1 is the registry number for N-Despropyl Pergolide. Offered by: TRC. Available pack sizes: 10mg, 2mg, 5mg.
(6aR,9R,10aR)-9-(methylsulfanylmethyl)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline (CAS 72821-91-1) is a chemical compound with the molecular formula C16H20N2S and a molecular weight of 272.4 g/mol. IUPAC name: (6aR,9R,10aR)-9-(methylsulfanylmethyl)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline. InChIKey: BHDLEAVQICQCHC-WDBKCZKBSA-N.
| Molecular formula | C16H20N2S |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | (6aR,9R,10aR)-9-(methylsulfanylmethyl)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline |
| InChIKey | BHDLEAVQICQCHC-WDBKCZKBSA-N |
| SMILES | CSC[C@@H]1C[C@H]2[C@@H](CC3=CNC4=CC=CC2=C34)NC1 |
Computed by PubChem (NCBI)