CAS 72822-01-6 appears in our catalog under these names: Pergolide mesilate EP Impurity A, Pergolide Sulfoxide, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(6aR,9R,10aR)-9-(methylsulfinylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline (CAS 72822-01-6) is a chemical compound with the molecular formula C19H26N2OS and a molecular weight of 330.5 g/mol. IUPAC name: (6aR,9R,10aR)-9-(methylsulfinylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline. InChIKey: WOIHSNDTPKFAJW-LNWQLOGCSA-N.
| Molecular formula | C19H26N2OS |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | (6aR,9R,10aR)-9-(methylsulfinylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
| InChIKey | WOIHSNDTPKFAJW-LNWQLOGCSA-N |
| SMILES | CCCN1C[C@@H](C[C@H]2[C@H]1CC3=CNC4=CC=CC2=C34)CS(=O)C |
Computed by PubChem (NCBI)