CAS 72822-03-8 appears in our catalog under these names: Pergolide Sulfone, >95% (HPLC), Pergolide sulfone. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 10 mg.
(6aR,9R,10aR)-9-(methylsulfonylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline (CAS 72822-03-8) is a chemical compound with the molecular formula C19H26N2O2S and a molecular weight of 346.5 g/mol. IUPAC name: (6aR,9R,10aR)-9-(methylsulfonylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline. InChIKey: BRFHHAXHZFOBNY-MZMPZRCHSA-N.
| Molecular formula | C19H26N2O2S |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | (6aR,9R,10aR)-9-(methylsulfonylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
| InChIKey | BRFHHAXHZFOBNY-MZMPZRCHSA-N |
| SMILES | CCCN1C[C@@H](C[C@H]2[C@H]1CC3=CNC4=CC=CC2=C34)CS(=O)(=O)C |
Computed by PubChem (NCBI)