CAS 72842-05-8 appears in our catalog under these names: Citicoline Impurity 7, Cytidine Impurity 5 discontinued see RM-C205906. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
CAS 72842-05-8 identifies a chemical compound with the molecular formula C11H20N4NaO11P2 and a molecular weight of 469.23 g/mol. InChIKey: QHTGCSYPHRDJMR-RQDZQORCSA-N.
| Molecular formula | C11H20N4NaO11P2 |
|---|---|
| Molecular weight | 469.23 g/mol |
| InChIKey | QHTGCSYPHRDJMR-RQDZQORCSA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)OCCN)O)O.[Na] |
Computed by PubChem (NCBI)