CAS 72851-41-3 appears in our catalog under these names: Benzo(k)fluoranthene-7,12-dicarbonitrile, >95% (HPLC), 7,12-Dicyanobenzo(k)fluoranthene. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 1g, 250mg, 5g, 50mg.
Benzo[k]fluoranthene-7,12-dicarbonitrile (CAS 72851-41-3) is a chemical compound with the molecular formula C22H10N2 and a molecular weight of 302.3 g/mol. IUPAC name: benzo[k]fluoranthene-7,12-dicarbonitrile. InChIKey: OIELEHOHWKWREL-UHFFFAOYSA-N.
| Molecular formula | C22H10N2 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | benzo[k]fluoranthene-7,12-dicarbonitrile |
| InChIKey | OIELEHOHWKWREL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C4=CC=CC5=C4C(=CC=C5)C3=C2C#N)C#N |
Computed by PubChem (NCBI)