CAS 72882-82-7 appears in our catalog under these names: (3R,6S)-3,6-Diethylpiperazine-2,5-dione, 98%, (3S,6R)-3,6-Diethylpiperazine-2,5-dione, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 5g, 10g.
(3R,6S)-3,6-diethylpiperazine-2,5-dione (CAS 72882-82-7) is a chemical compound with the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. IUPAC name: (3R,6S)-3,6-diethylpiperazine-2,5-dione. InChIKey: GWYVTXHULIXIAY-OLQVQODUSA-N.
| Molecular formula | C8H14N2O2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | (3R,6S)-3,6-diethylpiperazine-2,5-dione |
| InChIKey | GWYVTXHULIXIAY-OLQVQODUSA-N |
| SMILES | CC[C@@H]1C(=O)N[C@H](C(=O)N1)CC |
Computed by PubChem (NCBI)