CAS 728864-95-7 is the registry number for 5-(Azepane-1-carboxamido)naphthalene-1-sulfonyl chloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-(azepane-1-carbonylamino)naphthalene-1-sulfonyl chloride (CAS 728864-95-7) is a chemical compound with the molecular formula C17H19ClN2O3S and a molecular weight of 366.9 g/mol. IUPAC name: 5-(azepane-1-carbonylamino)naphthalene-1-sulfonyl chloride. InChIKey: ZTBFMTLZFXGGPO-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2O3S |
|---|---|
| Molecular weight | 366.9 g/mol |
| IUPAC name | 5-(azepane-1-carbonylamino)naphthalene-1-sulfonyl chloride |
| InChIKey | ZTBFMTLZFXGGPO-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)C(=O)NC2=CC=CC3=C2C=CC=C3S(=O)(=O)Cl |
Computed by PubChem (NCBI)